C24H21Cl2N3O2 — CID 175782926
2-[[2-chloro-4-(3-chloro-4-deuteriophenyl)phenyl]diazenyl]-N-(2,4-dimethylphenyl)-3-oxobutanamide (PubChem CID 175782926) has the molecular formula C24H21Cl2N3O2 and a molecular weight of 455.36 g/mol. Its IUPAC name is 2-[[2-chloro-4-(3-chloro-4-deuteriophenyl)phenyl]diazenyl]-N-(2,4-dimethylphenyl)-3-oxobutanamide.
| Compound Name | 2-[[2-chloro-4-(3-chloro-4-deuteriophenyl)phenyl]diazenyl]-N-(2,4-dimethylphenyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 175782926 |
| Molecular Formula | C24H21Cl2N3O2 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-[[2-chloro-4-(3-chloro-4-deuteriophenyl)phenyl]diazenyl]-N-(2,4-dimethylphenyl)-3-oxobutanamide |
| SMILES | [2H]c1ccc(-c2ccc(/N=N/C(C(C)=O)C(=O)Nc3ccc(C)cc3C)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C24H21Cl2N3O2/c1-14-7-9-21(15(2)11-14)27-24(31)23(16(3)30)29-28-22-10-8-18(13-20(22)26)17-5-4-6-19(25)12-17/h4-13,23H,1-3H3,(H,27,31)/b29-28+/i6D |
| InChIKey | JOOOMSWMHYYOAB-GYZXXTQSSA-N |
| XLogP | 6.96 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|