C18H19N4O6S- — CID 163874671
4-[[1-(2-methylanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-[methyl(oxido)azaniumyl]benzenesulfonate (PubChem CID 163874671) has the molecular formula C18H19N4O6S- and a molecular weight of 419.44 g/mol. Its IUPAC name is 4-[[1-(2-methylanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-[methyl(oxido)azaniumyl]benzenesulfonate.
| Compound Name | 4-[[1-(2-methylanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-[methyl(oxido)azaniumyl]benzenesulfonate |
|---|---|
| PubChem CID | 163874671 |
| Molecular Formula | C18H19N4O6S- |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 4-[[1-(2-methylanilino)-1,3-dioxobutan-2-yl]diazenyl]-3-[methyl(oxido)azaniumyl]benzenesulfonate |
| SMILES | CC(=O)C(/N=N/c1ccc(S(=O)(=O)[O-])cc1[NH+](C)[O-])C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C18H20N4O6S/c1-11-6-4-5-7-14(11)19-18(24)17(12(2)23)21-20-15-9-8-13(29(26,27)28)10-16(15)22(3)25/h4-10,17,22H,1-3H3,(H,19,24)(H,26,27,28)/p-1/b21-20+ |
| InChIKey | PNVLKCVOJKJHKT-QZQOTICOSA-M |
| XLogP | 1.22 |
| TPSA | 155.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|