C25H25N5O12S2 — CID 142838596
4-[[2-[[4-[(4-aminobenzoyl)amino]-5-methoxy-2-sulfophenyl]diazenyl]-3-oxobutanoyl]amino]-5-hydroperoxy-2-methylbenzenesulfonic acid (PubChem CID 142838596) has the molecular formula C25H25N5O12S2 and a molecular weight of 651.63 g/mol. Its IUPAC name is 4-[[2-[[4-[(4-aminobenzoyl)amino]-5-methoxy-2-sulfophenyl]diazenyl]-3-oxobutanoyl]amino]-5-hydroperoxy-2-methylbenzenesulfonic acid.
| Compound Name | 4-[[2-[[4-[(4-aminobenzoyl)amino]-5-methoxy-2-sulfophenyl]diazenyl]-3-oxobutanoyl]amino]-5-hydroperoxy-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 142838596 |
| Molecular Formula | C25H25N5O12S2 |
| Molecular Weight | 651.63 g/mol |
| Exact Mass | 651.09 |
| IUPAC Name | 4-[[2-[[4-[(4-aminobenzoyl)amino]-5-methoxy-2-sulfophenyl]diazenyl]-3-oxobutanoyl]amino]-5-hydroperoxy-2-methylbenzenesulfonic acid |
| SMILES | COc1cc(/N=N/C(C(C)=O)C(=O)Nc2cc(C)c(S(=O)(=O)O)cc2OO)c(S(=O)(=O)O)cc1NC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C25H25N5O12S2/c1-12-8-16(20(42-34)11-21(12)43(35,36)37)28-25(33)23(13(2)31)30-29-18-9-19(41-3)17(10-22(18)44(38,39)40)27-24(32)14-4-6-15(26)7-5-14/h4-11,23,34H,26H2,1-3H3,(H,27,32)(H,28,33)(H,35,36,37)(H,38,39,40)/b30-29+ |
| InChIKey | JOIBVIWBIUZYAX-QVIHXGFCSA-N |
| XLogP | 2.86 |
| TPSA | 273.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.63 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|