C22H20N4O8S — CID 3020222
5-[[4-[(3-aminobenzoyl)amino]-5-methoxy-2-methylphenyl]diazenyl]-2-hydroxy-3-sulfobenzoic acid (PubChem CID 3020222) has the molecular formula C22H20N4O8S and a molecular weight of 500.49 g/mol. Its IUPAC name is 5-[[4-[(3-aminobenzoyl)amino]-5-methoxy-2-methylphenyl]diazenyl]-2-hydroxy-3-sulfobenzoic acid.
| Compound Name | 5-[[4-[(3-aminobenzoyl)amino]-5-methoxy-2-methylphenyl]diazenyl]-2-hydroxy-3-sulfobenzoic acid |
|---|---|
| PubChem CID | 3020222 |
| Molecular Formula | C22H20N4O8S |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 5-[[4-[(3-aminobenzoyl)amino]-5-methoxy-2-methylphenyl]diazenyl]-2-hydroxy-3-sulfobenzoic acid |
| SMILES | COc1cc(/N=N/c2cc(C(=O)O)c(O)c(S(=O)(=O)O)c2)c(C)cc1NC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C22H20N4O8S/c1-11-6-17(24-21(28)12-4-3-5-13(23)7-12)18(34-2)10-16(11)26-25-14-8-15(22(29)30)20(27)19(9-14)35(31,32)33/h3-10,27H,23H2,1-2H3,(H,24,28)(H,29,30)(H,31,32,33)/b26-25+ |
| InChIKey | BUQAUTCFQDXNMT-OCEACIFDSA-N |
| XLogP | 3.90 |
| TPSA | 200.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|