C42H39N7NaO14S2 — CID 170839222
CID 170839222 (PubChem CID 170839222) has the molecular formula C42H39N7NaO14S2 and a molecular weight of 952.93 g/mol.
| Compound Name | CID 170839222 |
|---|---|
| PubChem CID | 170839222 |
| Molecular Formula | C42H39N7NaO14S2 |
| Molecular Weight | 952.93 g/mol |
| Exact Mass | 952.19 |
| IUPAC Name | — |
| SMILES | COc1cc(-c2ccc(NC(=O)C(/N=N/c3cc(S(=O)(=O)O)cc(NC(=O)c4ccccc4)c3O)C(C)=O)c(OC)c2)ccc1NC(=O)C(/N=N/c1cc(S(C)(=O)=O)ccc1O)C(C)=O.[Na] |
| InChI | InChI=1S/C42H39N7O14S2.Na/c1-22(50)37(48-46-31-19-27(64(5,57)58)13-16-34(31)52)41(55)43-29-14-11-25(17-35(29)62-3)26-12-15-30(36(18-26)63-4)44-42(56)38(23(2)51)49-47-33-21-28(65(59,60)61)20-32(39(33)53)45-40(54)24-9-7-6-8-10-24;/h6-21,37-38,52-53H,1-5H3,(H,43,55)(H,44,56)(H,45,54)(H,59,60,61);/b48-46+,49-47+; |
| InChIKey | GHWYLECGPLYSLT-KGFLNXJKSA-N |
| XLogP | 5.66 |
| TPSA | 318.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 66 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.93 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|