C15H21NO5S — CID 142838663
5-ethoxy-2-methyl-4-[(3-methyl-4-oxopent-1-en-2-yl)amino]benzenesulfonic acid (PubChem CID 142838663) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is 5-ethoxy-2-methyl-4-[(3-methyl-4-oxopent-1-en-2-yl)amino]benzenesulfonic acid.
| Compound Name | 5-ethoxy-2-methyl-4-[(3-methyl-4-oxopent-1-en-2-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 142838663 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 5-ethoxy-2-methyl-4-[(3-methyl-4-oxopent-1-en-2-yl)amino]benzenesulfonic acid |
| SMILES | C=C(Nc1cc(C)c(S(=O)(=O)O)cc1OCC)C(C)C(C)=O |
| InChI | InChI=1S/C15H21NO5S/c1-6-21-14-8-15(22(18,19)20)9(2)7-13(14)16-11(4)10(3)12(5)17/h7-8,10,16H,4,6H2,1-3,5H3,(H,18,19,20) |
| InChIKey | CVISNIMTNOOIQT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|