C12H15NO6S — CID 18365872
5-methoxy-4-methyl-2-(3-oxobutanoylamino)benzenesulfonic acid (PubChem CID 18365872) has the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. Its IUPAC name is 5-methoxy-4-methyl-2-(3-oxobutanoylamino)benzenesulfonic acid.
| Compound Name | 5-methoxy-4-methyl-2-(3-oxobutanoylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 18365872 |
| Molecular Formula | C12H15NO6S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-methoxy-4-methyl-2-(3-oxobutanoylamino)benzenesulfonic acid |
| SMILES | COc1cc(S(=O)(=O)O)c(NC(=O)CC(C)=O)cc1C |
| InChI | InChI=1S/C12H15NO6S/c1-7-4-9(13-12(15)5-8(2)14)11(20(16,17)18)6-10(7)19-3/h4,6H,5H2,1-3H3,(H,13,15)(H,16,17,18) |
| InChIKey | DAFWPLNJBFUCGL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|