C20H23N3O8S2 — CID 88802714
2-[4-[[5-methoxy-2-methyl-4-(3-oxobutanoylamino)phenyl]diazenyl]phenyl]sulfonylethanesulfonic acid (PubChem CID 88802714) has the molecular formula C20H23N3O8S2 and a molecular weight of 497.55 g/mol. Its IUPAC name is 2-[4-[[5-methoxy-2-methyl-4-(3-oxobutanoylamino)phenyl]diazenyl]phenyl]sulfonylethanesulfonic acid.
| Compound Name | 2-[4-[[5-methoxy-2-methyl-4-(3-oxobutanoylamino)phenyl]diazenyl]phenyl]sulfonylethanesulfonic acid |
|---|---|
| PubChem CID | 88802714 |
| Molecular Formula | C20H23N3O8S2 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 2-[4-[[5-methoxy-2-methyl-4-(3-oxobutanoylamino)phenyl]diazenyl]phenyl]sulfonylethanesulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc(S(=O)(=O)CCS(=O)(=O)O)cc2)c(C)cc1NC(=O)CC(C)=O |
| InChI | InChI=1S/C20H23N3O8S2/c1-13-10-18(21-20(25)11-14(2)24)19(31-3)12-17(13)23-22-15-4-6-16(7-5-15)32(26,27)8-9-33(28,29)30/h4-7,10,12H,8-9,11H2,1-3H3,(H,21,25)(H,28,29,30)/b23-22+ |
| InChIKey | KJVXGXIWFJJRGA-GHVJWSGMSA-N |
| XLogP | 3.00 |
| TPSA | 168.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|