C18H23N3O10S3 — CID 59012394
[4-[[2-methoxy-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]-2,5-dimethylanilino]methanesulfonic acid (PubChem CID 59012394) has the molecular formula C18H23N3O10S3 and a molecular weight of 537.59 g/mol. Its IUPAC name is [4-[[2-methoxy-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]-2,5-dimethylanilino]methanesulfonic acid.
| Compound Name | [4-[[2-methoxy-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]-2,5-dimethylanilino]methanesulfonic acid |
|---|---|
| PubChem CID | 59012394 |
| Molecular Formula | C18H23N3O10S3 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | [4-[[2-methoxy-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]-2,5-dimethylanilino]methanesulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)CCOSOOO)cc1/N=N/c1cc(C)c(NCS(=O)(=O)O)cc1C |
| InChI | InChI=1S/C18H23N3O10S3/c1-12-9-16(13(2)8-15(12)19-11-34(25,26)27)20-21-17-10-14(4-5-18(17)28-3)33(23,24)7-6-29-32-31-30-22/h4-5,8-10,19,22H,6-7,11H2,1-3H3,(H,25,26,27)/b21-20+ |
| InChIKey | VMKJEZDFRQIACI-QZQOTICOSA-N |
| XLogP | 3.76 |
| TPSA | 182.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|