C19H24ClN3O11S3 — CID 22886164
2-[4-[[2-chloro-4-[ethyl-[2-(trioxidanylsulfanyloxy)ethyl]amino]-5-methoxyphenyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate (PubChem CID 22886164) has the molecular formula C19H24ClN3O11S3 and a molecular weight of 602.07 g/mol. Its IUPAC name is 2-[4-[[2-chloro-4-[ethyl-[2-(trioxidanylsulfanyloxy)ethyl]amino]-5-methoxyphenyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[4-[[2-chloro-4-[ethyl-[2-(trioxidanylsulfanyloxy)ethyl]amino]-5-methoxyphenyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 22886164 |
| Molecular Formula | C19H24ClN3O11S3 |
| Molecular Weight | 602.07 g/mol |
| Exact Mass | 601.03 |
| IUPAC Name | 2-[4-[[2-chloro-4-[ethyl-[2-(trioxidanylsulfanyloxy)ethyl]amino]-5-methoxyphenyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate |
| SMILES | CCN(CCOSOOO)c1cc(Cl)c(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C19H24ClN3O11S3/c1-3-23(8-9-31-35-34-33-24)18-12-16(20)17(13-19(18)30-2)22-21-14-4-6-15(7-5-14)36(25,26)11-10-32-37(27,28)29/h4-7,12-13,24H,3,8-11H2,1-2H3,(H,27,28,29)/b22-21+ |
| InChIKey | FMSQVCZGOCQDQY-QURGRASLSA-N |
| XLogP | 4.18 |
| TPSA | 182.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.07 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|