C18H21N3Na2O10S3 — CID 13007465
disodium;2-[4-[[4-[ethyl(2-sulfonatooxyethyl)amino]phenyl]diazenyl]phenyl]sulfonylethyl sulfate (PubChem CID 13007465) has the molecular formula C18H21N3Na2O10S3 and a molecular weight of 581.56 g/mol. Its IUPAC name is disodium;2-[4-[[4-[ethyl(2-sulfonatooxyethyl)amino]phenyl]diazenyl]phenyl]sulfonylethyl sulfate.
| Compound Name | disodium;2-[4-[[4-[ethyl(2-sulfonatooxyethyl)amino]phenyl]diazenyl]phenyl]sulfonylethyl sulfate |
|---|---|
| PubChem CID | 13007465 |
| Molecular Formula | C18H21N3Na2O10S3 |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 581.02 |
| IUPAC Name | disodium;2-[4-[[4-[ethyl(2-sulfonatooxyethyl)amino]phenyl]diazenyl]phenyl]sulfonylethyl sulfate |
| SMILES | CCN(CCOS(=O)(=O)[O-])c1ccc(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)[O-])cc2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C18H23N3O10S3.2Na/c1-2-21(11-12-30-33(24,25)26)17-7-3-15(4-8-17)19-20-16-5-9-18(10-6-16)32(22,23)14-13-31-34(27,28)29;;/h3-10H,2,11-14H2,1H3,(H,24,25,26)(H,27,28,29);;/q;2*+1/p-2/b20-19+;; |
| InChIKey | UVBLXBLXEIFQLD-LLIZZRELSA-L |
| XLogP | -4.34 |
| TPSA | 194.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|