C13H16N7O6S- — CID 140655740
2-[N-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)diazenyl]-2-nitroanilino]ethyl sulfate (PubChem CID 140655740) has the molecular formula C13H16N7O6S- and a molecular weight of 398.38 g/mol. Its IUPAC name is 2-[N-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)diazenyl]-2-nitroanilino]ethyl sulfate.
| Compound Name | 2-[N-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)diazenyl]-2-nitroanilino]ethyl sulfate |
|---|---|
| PubChem CID | 140655740 |
| Molecular Formula | C13H16N7O6S- |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-[N-ethyl-4-[(4-methyl-1,2,4-triazol-3-yl)diazenyl]-2-nitroanilino]ethyl sulfate |
| SMILES | CCN(CCOS(=O)(=O)[O-])c1ccc(/N=N/c2nncn2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N7O6S/c1-3-19(6-7-26-27(23,24)25)11-5-4-10(8-12(11)20(21)22)15-17-13-16-14-9-18(13)2/h4-5,8-9H,3,6-7H2,1-2H3,(H,23,24,25)/p-1/b17-15+ |
| InChIKey | GRSUGTOITUZMDW-BMRADRMJSA-M |
| XLogP | 1.44 |
| TPSA | 168.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|