C11H13N7O6S — CID 136608708
2-[N-methyl-2-nitro-4-(1H-1,2,4-triazol-5-yldiazenyl)anilino]ethyl hydrogen sulfate (PubChem CID 136608708) has the molecular formula C11H13N7O6S and a molecular weight of 371.34 g/mol. Its IUPAC name is 2-[N-methyl-2-nitro-4-(1H-1,2,4-triazol-5-yldiazenyl)anilino]ethyl hydrogen sulfate.
| Compound Name | 2-[N-methyl-2-nitro-4-(1H-1,2,4-triazol-5-yldiazenyl)anilino]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 136608708 |
| Molecular Formula | C11H13N7O6S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-[N-methyl-2-nitro-4-(1H-1,2,4-triazol-5-yldiazenyl)anilino]ethyl hydrogen sulfate |
| SMILES | CN(CCOS(=O)(=O)O)c1ccc(/N=N/c2ncn[nH]2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N7O6S/c1-17(4-5-24-25(21,22)23)9-3-2-8(6-10(9)18(19)20)14-16-11-12-7-13-15-11/h2-3,6-7H,4-5H2,1H3,(H,12,13,15)(H,21,22,23)/b16-14+ |
| InChIKey | HCYPTBQRZNDYDU-JQIJEIRASA-N |
| XLogP | 1.38 |
| TPSA | 176.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|