C13H14N5O7S- — CID 140655745
2-[N-ethyl-3-nitro-4-(1,2-oxazol-5-yldiazenyl)anilino]ethyl sulfate (PubChem CID 140655745) has the molecular formula C13H14N5O7S- and a molecular weight of 384.35 g/mol. Its IUPAC name is 2-[N-ethyl-3-nitro-4-(1,2-oxazol-5-yldiazenyl)anilino]ethyl sulfate.
| Compound Name | 2-[N-ethyl-3-nitro-4-(1,2-oxazol-5-yldiazenyl)anilino]ethyl sulfate |
|---|---|
| PubChem CID | 140655745 |
| Molecular Formula | C13H14N5O7S- |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2-[N-ethyl-3-nitro-4-(1,2-oxazol-5-yldiazenyl)anilino]ethyl sulfate |
| SMILES | CCN(CCOS(=O)(=O)[O-])c1ccc(/N=N/c2ccno2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15N5O7S/c1-2-17(7-8-24-26(21,22)23)10-3-4-11(12(9-10)18(19)20)15-16-13-5-6-14-25-13/h3-6,9H,2,7-8H2,1H3,(H,21,22,23)/p-1/b16-15+ |
| InChIKey | PORSPTRBKWBNNV-FOCLMDBBSA-M |
| XLogP | 2.30 |
| TPSA | 163.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|