C19H22N6 — CID 167146901
N-ethyl-N-[(3-methylphenyl)methyl]-4-[(4-methyl-1,2,4-triazol-3-yl)diazenyl]aniline (PubChem CID 167146901) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is N-ethyl-N-[(3-methylphenyl)methyl]-4-[(4-methyl-1,2,4-triazol-3-yl)diazenyl]aniline.
| Compound Name | N-ethyl-N-[(3-methylphenyl)methyl]-4-[(4-methyl-1,2,4-triazol-3-yl)diazenyl]aniline |
|---|---|
| PubChem CID | 167146901 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-ethyl-N-[(3-methylphenyl)methyl]-4-[(4-methyl-1,2,4-triazol-3-yl)diazenyl]aniline |
| SMILES | CCN(Cc1cccc(C)c1)c1ccc(/N=N/c2nncn2C)cc1 |
| InChI | InChI=1S/C19H22N6/c1-4-25(13-16-7-5-6-15(2)12-16)18-10-8-17(9-11-18)21-23-19-22-20-14-24(19)3/h5-12,14H,4,13H2,1-3H3/b23-21+ |
| InChIKey | PPGLUNZKKOWGBC-XTQSDGFTSA-N |
| XLogP | 4.57 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|