C13H18N6O4S — CID 160623124
carbanylium;2-[N-methyl-4-[(1-methyl-1,2,4-triazol-3-yl)diazenyl]anilino]ethyl sulfate (PubChem CID 160623124) has the molecular formula C13H18N6O4S and a molecular weight of 354.39 g/mol. Its IUPAC name is carbanylium;2-[N-methyl-4-[(1-methyl-1,2,4-triazol-3-yl)diazenyl]anilino]ethyl sulfate.
| Compound Name | carbanylium;2-[N-methyl-4-[(1-methyl-1,2,4-triazol-3-yl)diazenyl]anilino]ethyl sulfate |
|---|---|
| PubChem CID | 160623124 |
| Molecular Formula | C13H18N6O4S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | carbanylium;2-[N-methyl-4-[(1-methyl-1,2,4-triazol-3-yl)diazenyl]anilino]ethyl sulfate |
| SMILES | CN(CCOS(=O)(=O)[O-])c1ccc(/N=N/c2ncn(C)n2)cc1.[CH3+] |
| InChI | InChI=1S/C12H16N6O4S.CH3/c1-17(7-8-22-23(19,20)21)11-5-3-10(4-6-11)14-15-12-13-9-18(2)16-12;/h3-6,9H,7-8H2,1-2H3,(H,19,20,21);1H3/q;+1/p-1/b15-14+; |
| InChIKey | RGYMTJOIINAHJI-WPDLWGESSA-M |
| XLogP | 1.59 |
| TPSA | 125.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|