C12H20N2O2S — CID 84708887
4-(2-aminoethylsulfonyl)-N,N-diethylaniline (PubChem CID 84708887) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 4-(2-aminoethylsulfonyl)-N,N-diethylaniline.
| Compound Name | 4-(2-aminoethylsulfonyl)-N,N-diethylaniline |
|---|---|
| PubChem CID | 84708887 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-(2-aminoethylsulfonyl)-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)CCN)cc1 |
| InChI | InChI=1S/C12H20N2O2S/c1-3-14(4-2)11-5-7-12(8-6-11)17(15,16)10-9-13/h5-8H,3-4,9-10,13H2,1-2H3 |
| InChIKey | WZDUXJQRQQKCDX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |