C11H14F3NO2S — CID 890760
N,N-diethyl-4-(trifluoromethylsulfonyl)aniline (PubChem CID 890760) has the molecular formula C11H14F3NO2S and a molecular weight of 281.30 g/mol. Its IUPAC name is N,N-diethyl-4-(trifluoromethylsulfonyl)aniline.
| Compound Name | N,N-diethyl-4-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 890760 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N,N-diethyl-4-(trifluoromethylsulfonyl)aniline |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NO2S/c1-3-15(4-2)9-5-7-10(8-6-9)18(16,17)11(12,13)14/h5-8H,3-4H2,1-2H3 |
| InChIKey | NOZBCWVNFLUKIF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |