C21H27N3O4S — CID 9156253
4-(diethylamino)-N'-[3-(4-methylphenyl)sulfonylpropanoyl]benzohydrazide (PubChem CID 9156253) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is 4-(diethylamino)-N'-[3-(4-methylphenyl)sulfonylpropanoyl]benzohydrazide.
| Compound Name | 4-(diethylamino)-N'-[3-(4-methylphenyl)sulfonylpropanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9156253 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 4-(diethylamino)-N'-[3-(4-methylphenyl)sulfonylpropanoyl]benzohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNC(=O)CCS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H27N3O4S/c1-4-24(5-2)18-10-8-17(9-11-18)21(26)23-22-20(25)14-15-29(27,28)19-12-6-16(3)7-13-19/h6-13H,4-5,14-15H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | CTOKMBULENCXOC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|