C19H25N3O8S2 — CID 13007468
2-[4-[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate (PubChem CID 13007468) has the molecular formula C19H25N3O8S2 and a molecular weight of 487.56 g/mol. Its IUPAC name is 2-[4-[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[4-[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 13007468 |
| Molecular Formula | C19H25N3O8S2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 2-[4-[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate |
| SMILES | Cc1cc(N(CCO)CCO)ccc1/N=N/c1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H25N3O8S2/c1-15-14-17(22(8-10-23)9-11-24)4-7-19(15)21-20-16-2-5-18(6-3-16)31(25,26)13-12-30-32(27,28)29/h2-7,14,23-24H,8-13H2,1H3,(H,27,28,29)/b21-20+ |
| InChIKey | SOQCXNUOZOVEOS-QZQOTICOSA-N |
| XLogP | 1.79 |
| TPSA | 166.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|