C18H22ClN3O14S4 — CID 146159961
2-[4-[[4-[bis(2-sulfooxyethyl)amino]phenyl]diazenyl]-2-chlorophenyl]sulfonylethyl hydrogen sulfate (PubChem CID 146159961) has the molecular formula C18H22ClN3O14S4 and a molecular weight of 668.10 g/mol. Its IUPAC name is 2-[4-[[4-[bis(2-sulfooxyethyl)amino]phenyl]diazenyl]-2-chlorophenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[4-[[4-[bis(2-sulfooxyethyl)amino]phenyl]diazenyl]-2-chlorophenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 146159961 |
| Molecular Formula | C18H22ClN3O14S4 |
| Molecular Weight | 668.10 g/mol |
| Exact Mass | 666.97 |
| IUPAC Name | 2-[4-[[4-[bis(2-sulfooxyethyl)amino]phenyl]diazenyl]-2-chlorophenyl]sulfonylethyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OCCN(CCOS(=O)(=O)O)c1ccc(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H22ClN3O14S4/c19-17-13-15(3-6-18(17)37(23,24)12-11-36-40(31,32)33)21-20-14-1-4-16(5-2-14)22(7-9-34-38(25,26)27)8-10-35-39(28,29)30/h1-6,13H,7-12H2,(H,25,26,27)(H,28,29,30)(H,31,32,33)/b21-20+ |
| InChIKey | MNKPLEWINRJKAR-QZQOTICOSA-N |
| XLogP | 1.79 |
| TPSA | 252.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.10 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|