C8H12N2O6S2 — CID 14273541
2-(2,4-diaminophenyl)sulfonylethyl hydrogen sulfate (PubChem CID 14273541) has the molecular formula C8H12N2O6S2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-(2,4-diaminophenyl)sulfonylethyl hydrogen sulfate.
| Compound Name | 2-(2,4-diaminophenyl)sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 14273541 |
| Molecular Formula | C8H12N2O6S2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 2-(2,4-diaminophenyl)sulfonylethyl hydrogen sulfate |
| SMILES | Nc1ccc(S(=O)(=O)CCOS(=O)(=O)O)c(N)c1 |
| InChI | InChI=1S/C8H12N2O6S2/c9-6-1-2-8(7(10)5-6)17(11,12)4-3-16-18(13,14)15/h1-2,5H,3-4,9-10H2,(H,13,14,15) |
| InChIKey | JEIDSPQQTRXBOX-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|