C8H11NO7S2 — CID 88707144
2-(2-amino-3-hydroxyphenyl)sulfonylethyl hydrogen sulfate (PubChem CID 88707144) has the molecular formula C8H11NO7S2 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-(2-amino-3-hydroxyphenyl)sulfonylethyl hydrogen sulfate.
| Compound Name | 2-(2-amino-3-hydroxyphenyl)sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 88707144 |
| Molecular Formula | C8H11NO7S2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 2-(2-amino-3-hydroxyphenyl)sulfonylethyl hydrogen sulfate |
| SMILES | Nc1c(O)cccc1S(=O)(=O)CCOS(=O)(=O)O |
| InChI | InChI=1S/C8H11NO7S2/c9-8-6(10)2-1-3-7(8)17(11,12)5-4-16-18(13,14)15/h1-3,10H,4-5,9H2,(H,13,14,15) |
| InChIKey | ZCEXRFDKEMJHLK-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|