C10H15NO8S2 — CID 174346145
2-[3-(dimethoxyamino)phenyl]sulfonylethyl hydrogen sulfate (PubChem CID 174346145) has the molecular formula C10H15NO8S2 and a molecular weight of 341.36 g/mol. Its IUPAC name is 2-[3-(dimethoxyamino)phenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[3-(dimethoxyamino)phenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 174346145 |
| Molecular Formula | C10H15NO8S2 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 2-[3-(dimethoxyamino)phenyl]sulfonylethyl hydrogen sulfate |
| SMILES | CON(OC)c1cccc(S(=O)(=O)CCOS(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H15NO8S2/c1-17-11(18-2)9-4-3-5-10(8-9)20(12,13)7-6-19-21(14,15)16/h3-5,8H,6-7H2,1-2H3,(H,14,15,16) |
| InChIKey | DUKUUWFFVOAMFX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|