C22H20N2O11S3 — CID 90287178
1-amino-9,10-dioxo-4-[3-(2-sulfooxyethylsulfonyl)anilino]-4a,9a-dihydroanthracene-2-sulfonic acid (PubChem CID 90287178) has the molecular formula C22H20N2O11S3 and a molecular weight of 584.61 g/mol. Its IUPAC name is 1-amino-9,10-dioxo-4-[3-(2-sulfooxyethylsulfonyl)anilino]-4a,9a-dihydroanthracene-2-sulfonic acid.
| Compound Name | 1-amino-9,10-dioxo-4-[3-(2-sulfooxyethylsulfonyl)anilino]-4a,9a-dihydroanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 90287178 |
| Molecular Formula | C22H20N2O11S3 |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.02 |
| IUPAC Name | 1-amino-9,10-dioxo-4-[3-(2-sulfooxyethylsulfonyl)anilino]-4a,9a-dihydroanthracene-2-sulfonic acid |
| SMILES | NC1=C(S(=O)(=O)O)C=C(Nc2cccc(S(=O)(=O)CCOS(=O)(=O)O)c2)C2C(=O)c3ccccc3C(=O)C12 |
| InChI | InChI=1S/C22H20N2O11S3/c23-20-17(37(29,30)31)11-16(18-19(20)22(26)15-7-2-1-6-14(15)21(18)25)24-12-4-3-5-13(10-12)36(27,28)9-8-35-38(32,33)34/h1-7,10-11,18-19,24H,8-9,23H2,(H,29,30,31)(H,32,33,34) |
| InChIKey | PDSIREJDKGZIME-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 224.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|