C13H18F3NO3S — CID 115943806
2-[2-[(2-methylpropan-2-yl)oxy]ethylsulfonyl]-5-(trifluoromethyl)aniline (PubChem CID 115943806) has the molecular formula C13H18F3NO3S and a molecular weight of 325.35 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxy]ethylsulfonyl]-5-(trifluoromethyl)aniline.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxy]ethylsulfonyl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 115943806 |
| Molecular Formula | C13H18F3NO3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxy]ethylsulfonyl]-5-(trifluoromethyl)aniline |
| SMILES | CC(C)(C)OCCS(=O)(=O)c1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C13H18F3NO3S/c1-12(2,3)20-6-7-21(18,19)11-5-4-9(8-10(11)17)13(14,15)16/h4-5,8H,6-7,17H2,1-3H3 |
| InChIKey | MYYAJAQXECSBTK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|