C18H18N4O10S3 — CID 135587772
2-[4-[[4-hydroxy-3-methyl-1-[4-(trioxidanylsulfanyl)phenyl]pyrazol-5-yl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate (PubChem CID 135587772) has the molecular formula C18H18N4O10S3 and a molecular weight of 546.56 g/mol. Its IUPAC name is 2-[4-[[4-hydroxy-3-methyl-1-[4-(trioxidanylsulfanyl)phenyl]pyrazol-5-yl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[4-[[4-hydroxy-3-methyl-1-[4-(trioxidanylsulfanyl)phenyl]pyrazol-5-yl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 135587772 |
| Molecular Formula | C18H18N4O10S3 |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.02 |
| IUPAC Name | 2-[4-[[4-hydroxy-3-methyl-1-[4-(trioxidanylsulfanyl)phenyl]pyrazol-5-yl]diazenyl]phenyl]sulfonylethyl hydrogen sulfate |
| SMILES | Cc1nn(-c2ccc(SOOO)cc2)c(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2)c1O |
| InChI | InChI=1S/C18H18N4O10S3/c1-12-17(23)18(22(21-12)14-4-6-15(7-5-14)33-32-31-24)20-19-13-2-8-16(9-3-13)34(25,26)11-10-30-35(27,28)29/h2-9,23-24H,10-11H2,1H3,(H,27,28,29)/b20-19+ |
| InChIKey | HTZUQIXYOFQUAU-FMQUCBEESA-N |
| XLogP | 3.32 |
| TPSA | 199.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|