C19H21N5O10S3 — CID 11971418
4-[5-imino-4-[[2-methoxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-3-methyl-4H-pyrazol-1-yl]benzenesulfonic acid (PubChem CID 11971418) has the molecular formula C19H21N5O10S3 and a molecular weight of 575.60 g/mol. Its IUPAC name is 4-[5-imino-4-[[2-methoxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-3-methyl-4H-pyrazol-1-yl]benzenesulfonic acid.
| Compound Name | 4-[5-imino-4-[[2-methoxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-3-methyl-4H-pyrazol-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 11971418 |
| Molecular Formula | C19H21N5O10S3 |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | 4-[5-imino-4-[[2-methoxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-3-methyl-4H-pyrazol-1-yl]benzenesulfonic acid |
| SMILES | [H]/N=C1\C(/N=N/c2cc(S(=O)(=O)CCOS(=O)(=O)O)ccc2OC)C(C)=NN1c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H21N5O10S3/c1-12-18(19(20)24(23-12)13-3-5-14(6-4-13)36(27,28)29)22-21-16-11-15(7-8-17(16)33-2)35(25,26)10-9-34-37(30,31)32/h3-8,11,18,20H,9-10H2,1-2H3,(H,27,28,29)(H,30,31,32)/b20-19+,22-21+ |
| InChIKey | DXKQQLDAKDFCDH-DKHHWMATSA-N |
| XLogP | 1.86 |
| TPSA | 225.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|