C29H30N8O22S7 — CID 59858377
2-[[2,6-diamino-3,5-bis[[2-sulfo-4-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]phenyl]diazenyl]-5-methoxybenzenesulfonic acid (PubChem CID 59858377) has the molecular formula C29H30N8O22S7 and a molecular weight of 1067.06 g/mol. Its IUPAC name is 2-[[2,6-diamino-3,5-bis[[2-sulfo-4-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]phenyl]diazenyl]-5-methoxybenzenesulfonic acid.
| Compound Name | 2-[[2,6-diamino-3,5-bis[[2-sulfo-4-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]phenyl]diazenyl]-5-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 59858377 |
| Molecular Formula | C29H30N8O22S7 |
| Molecular Weight | 1067.06 g/mol |
| Exact Mass | 1065.95 |
| IUPAC Name | 2-[[2,6-diamino-3,5-bis[[2-sulfo-4-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]phenyl]diazenyl]phenyl]diazenyl]-5-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(/N=N/c2c(N)c(/N=N/c3ccc(S(=O)(=O)CCOSOOO)cc3S(=O)(=O)O)cc(/N=N/c3ccc(S(=O)(=O)CCOSOOO)cc3S(=O)(=O)O)c2N)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C29H30N8O22S7/c1-53-16-2-5-19(24(12-16)64(44,45)46)34-37-29-27(30)22(35-32-20-6-3-17(13-25(20)65(47,48)49)62(40,41)10-8-54-60-58-56-38)15-23(28(29)31)36-33-21-7-4-18(14-26(21)66(50,51)52)63(42,43)11-9-55-61-59-57-39/h2-7,12-15,38-39H,8-11,30-31H2,1H3,(H,44,45,46)(H,47,48,49)(H,50,51,52)/b35-32+,36-33+,37-34+ |
| InChIKey | RKIZOTHMNBLSLW-NCHUGQAOSA-N |
| XLogP | 5.40 |
| TPSA | 462.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 29 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 66 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.06 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 29 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|