C19H19N5O15S5 — CID 140535216
2-[[8-amino-1-hydroxy-7-(methyldiazenyl)-5-sulfino-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]benzenesulfonic acid (PubChem CID 140535216) has the molecular formula C19H19N5O15S5 and a molecular weight of 717.72 g/mol. Its IUPAC name is 2-[[8-amino-1-hydroxy-7-(methyldiazenyl)-5-sulfino-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]benzenesulfonic acid.
| Compound Name | 2-[[8-amino-1-hydroxy-7-(methyldiazenyl)-5-sulfino-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 140535216 |
| Molecular Formula | C19H19N5O15S5 |
| Molecular Weight | 717.72 g/mol |
| Exact Mass | 716.95 |
| IUPAC Name | 2-[[8-amino-1-hydroxy-7-(methyldiazenyl)-5-sulfino-3-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-[2-(trioxidanylsulfanyloxy)ethylsulfonyl]benzenesulfonic acid |
| SMILES | C/N=N/c1cc(S(=O)O)c2cc(SOOO)c(/N=N/c3ccc(S(=O)(=O)CCOSOOO)cc3S(=O)(=O)O)c(O)c2c1N |
| InChI | InChI=1S/C19H19N5O15S5/c1-21-22-12-8-14(42(28)29)10-7-13(40-38-36-26)18(19(25)16(10)17(12)20)24-23-11-3-2-9(6-15(11)44(32,33)34)43(30,31)5-4-35-41-39-37-27/h2-3,6-8,25-27H,4-5,20H2,1H3,(H,28,29)(H,32,33,34)/b22-21+,24-23+ |
| InChIKey | INDDDJNLDHIVNE-RLPYSRNMSA-N |
| XLogP | 4.29 |
| TPSA | 308.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.72 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|