C20H18F2N6O15S5 — CID 143998703
2,4-diamino-3-[(3,5-difluoro-2-sulfophenyl)diazenyl]-5-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid (PubChem CID 143998703) has the molecular formula C20H18F2N6O15S5 and a molecular weight of 780.72 g/mol. Its IUPAC name is 2,4-diamino-3-[(3,5-difluoro-2-sulfophenyl)diazenyl]-5-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2,4-diamino-3-[(3,5-difluoro-2-sulfophenyl)diazenyl]-5-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 143998703 |
| Molecular Formula | C20H18F2N6O15S5 |
| Molecular Weight | 780.72 g/mol |
| Exact Mass | 779.94 |
| IUPAC Name | 2,4-diamino-3-[(3,5-difluoro-2-sulfophenyl)diazenyl]-5-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]benzenesulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c1/N=N/c1cc(F)cc(F)c1S(=O)(=O)O |
| InChI | InChI=1S/C20H18F2N6O15S5/c21-9-5-11(22)20(47(37,38)39)14(6-9)27-28-19-17(23)13(8-16(18(19)24)46(34,35)36)26-25-12-2-1-10(7-15(12)45(31,32)33)44(29,30)4-3-43-48(40,41)42/h1-2,5-8H,3-4,23-24H2,(H,31,32,33)(H,34,35,36)(H,37,38,39)(H,40,41,42)/b26-25+,28-27+ |
| InChIKey | DFINLUQFQRPSHR-PAMTUDGESA-N |
| XLogP | 2.29 |
| TPSA | 362.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.72 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|