C9H12NaS+ — CID 22351999
sodium 2,4,5-trimethylbenzenethiol (PubChem CID 22351999) has the molecular formula C9H12NaS+ and a molecular weight of 175.25 g/mol. Its IUPAC name is sodium 2,4,5-trimethylbenzenethiol.
| Compound Name | sodium 2,4,5-trimethylbenzenethiol |
|---|---|
| PubChem CID | 22351999 |
| Molecular Formula | C9H12NaS+ |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | sodium 2,4,5-trimethylbenzenethiol |
| SMILES | Cc1cc(C)c(S)cc1C.[Na+] |
| InChI | InChI=1S/C9H12S.Na/c1-6-4-8(3)9(10)5-7(6)2;/h4-5,10H,1-3H3;/q;+1 |
| InChIKey | HOGSGRSWSMEDKY-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|