C8H11NO2S2 — CID 67169814
2,4-dimethyl-5-sulfanylbenzenesulfonamide (PubChem CID 67169814) has the molecular formula C8H11NO2S2 and a molecular weight of 217.31 g/mol. Its IUPAC name is 2,4-dimethyl-5-sulfanylbenzenesulfonamide.
| Compound Name | 2,4-dimethyl-5-sulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 67169814 |
| Molecular Formula | C8H11NO2S2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 2,4-dimethyl-5-sulfanylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(N)(=O)=O)cc1S |
| InChI | InChI=1S/C8H11NO2S2/c1-5-3-6(2)8(4-7(5)12)13(9,10)11/h3-4,12H,1-2H3,(H2,9,10,11) |
| InChIKey | KKLHGBVWDWLYLN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|