C10H13NO4S — CID 112551846
2,2,6-trimethyl-1,3-benzodioxole-5-sulfonamide (PubChem CID 112551846) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 2,2,6-trimethyl-1,3-benzodioxole-5-sulfonamide.
| Compound Name | 2,2,6-trimethyl-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 112551846 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2,2,6-trimethyl-1,3-benzodioxole-5-sulfonamide |
| SMILES | Cc1cc2c(cc1S(N)(=O)=O)OC(C)(C)O2 |
| InChI | InChI=1S/C10H13NO4S/c1-6-4-7-8(15-10(2,3)14-7)5-9(6)16(11,12)13/h4-5H,1-3H3,(H2,11,12,13) |
| InChIKey | AMWXADNDRWOLQS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |