C10H12OS — CID 130137149
1-(4,5-dimethyl-2-sulfanylphenyl)ethanone (PubChem CID 130137149) has the molecular formula C10H12OS and a molecular weight of 180.27 g/mol. Its IUPAC name is 1-(4,5-dimethyl-2-sulfanylphenyl)ethanone.
| Compound Name | 1-(4,5-dimethyl-2-sulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 130137149 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 1-(4,5-dimethyl-2-sulfanylphenyl)ethanone |
| SMILES | CC(=O)c1cc(C)c(C)cc1S |
| InChI | InChI=1S/C10H12OS/c1-6-4-9(8(3)11)10(12)5-7(6)2/h4-5,12H,1-3H3 |
| InChIKey | DIPURLGCFVWPSE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|