C10H12O2 — CID 119014480
1-(5-hydroxy-2,4-dimethylphenyl)ethanone (PubChem CID 119014480) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 1-(5-hydroxy-2,4-dimethylphenyl)ethanone.
| Compound Name | 1-(5-hydroxy-2,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 119014480 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1-(5-hydroxy-2,4-dimethylphenyl)ethanone |
| SMILES | CC(=O)c1cc(O)c(C)cc1C |
| InChI | InChI=1S/C10H12O2/c1-6-4-7(2)10(12)5-9(6)8(3)11/h4-5,12H,1-3H3 |
| InChIKey | XRIBYFOVMSSZLH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |