C12H12O3SZn+2 — CID 22351834
zinc 1-(3,5-diacetyl-4-sulfanylphenyl)ethanone (PubChem CID 22351834) has the molecular formula C12H12O3SZn+2 and a molecular weight of 301.68 g/mol. Its IUPAC name is zinc 1-(3,5-diacetyl-4-sulfanylphenyl)ethanone.
| Compound Name | zinc 1-(3,5-diacetyl-4-sulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 22351834 |
| Molecular Formula | C12H12O3SZn+2 |
| Molecular Weight | 301.68 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | zinc 1-(3,5-diacetyl-4-sulfanylphenyl)ethanone |
| SMILES | CC(=O)c1cc(C(C)=O)c(S)c(C(C)=O)c1.[Zn+2] |
| InChI | InChI=1S/C12H12O3S.Zn/c1-6(13)9-4-10(7(2)14)12(16)11(5-9)8(3)15;/h4-5,16H,1-3H3;/q;+2 |
| InChIKey | LXCCXWFYITXGAB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 51.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.68 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|