2,4,6-triacetylbenzoic acid

C13H12O5 — CID 126563511

IUPAC2,4,6-triacetylbenzoic acid
SMILESCC(=O)c1cc(C(C)=O)c(C(=O)O)c(C(C)=O)c1
InChIInChI=1S/C13H12O5/c1-6(14)9-4-10(7(2)15)12(13(17)18)11(5-9)8(3)16/h4-5H,1-3H3,(H,17,18)
InChIKeyLBENWHVQIWQZHG-UHFFFAOYSA-N
MW248.23 g/mol
LogP1.99
Rot. Bonds4

About 2,4,6-triacetylbenzoic acid

2,4,6-triacetylbenzoic acid (PubChem CID 126563511) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is 2,4,6-triacetylbenzoic acid.

Molecular Properties

Compound Name2,4,6-triacetylbenzoic acid
PubChem CID126563511
Molecular FormulaC13H12O5
Molecular Weight248.23 g/mol
Exact Mass248.07
IUPAC Name2,4,6-triacetylbenzoic acid
SMILESCC(=O)c1cc(C(C)=O)c(C(=O)O)c(C(C)=O)c1
InChIInChI=1S/C13H12O5/c1-6(14)9-4-10(7(2)15)12(13(17)18)11(5-9)8(3)16/h4-5H,1-3H3,(H,17,18)
InChIKeyLBENWHVQIWQZHG-UHFFFAOYSA-N
XLogP1.99
TPSA88.51 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.23
LogP ≤ 51.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2,4,6-triacetylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,6-triacetylbenzoic acid?
The IUPAC name of 2,4,6-triacetylbenzoic acid (CID 126563511) is 2,4,6-triacetylbenzoic acid.
What is the SMILES notation for 2,4,6-triacetylbenzoic acid?
The canonical SMILES for 2,4,6-triacetylbenzoic acid is CC(=O)c1cc(C(C)=O)c(C(=O)O)c(C(C)=O)c1.
What is the InChIKey of 2,4,6-triacetylbenzoic acid?
The InChIKey is LBENWHVQIWQZHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O5/c1-6(14)9-4-10(7(2)15)12(13(17)18)11(5-9)8(3)16/h4-5H,1-3H3,(H,17,18).
What are the key properties of 2,4,6-triacetylbenzoic acid?
2,4,6-triacetylbenzoic acid has a molecular weight of 248.23 g/mol, XLogP of 1.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-triacetylbenzoic acid is sourced from PubChem (CID 126563511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).