C9H9N3NaO3S+ — CID 22351625
sodium 2-sulfanylbenzene-1,3,5-tricarboxamide (PubChem CID 22351625) has the molecular formula C9H9N3NaO3S+ and a molecular weight of 262.25 g/mol. Its IUPAC name is sodium 2-sulfanylbenzene-1,3,5-tricarboxamide.
| Compound Name | sodium 2-sulfanylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 22351625 |
| Molecular Formula | C9H9N3NaO3S+ |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | sodium 2-sulfanylbenzene-1,3,5-tricarboxamide |
| SMILES | NC(=O)c1cc(C(N)=O)c(S)c(C(N)=O)c1.[Na+] |
| InChI | InChI=1S/C9H9N3O3S.Na/c10-7(13)3-1-4(8(11)14)6(16)5(2-3)9(12)15;/h1-2,16H,(H2,10,13)(H2,11,14)(H2,12,15);/q;+1 |
| InChIKey | VSOVRGJODCMPMK-UHFFFAOYSA-N |
| XLogP | -3.72 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|