C15H17N5O3 — CID 67830844
benzene-1,2-diamine;benzene-1,3,5-tricarboxamide (PubChem CID 67830844) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is benzene-1,2-diamine;benzene-1,3,5-tricarboxamide.
| Compound Name | benzene-1,2-diamine;benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 67830844 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | benzene-1,2-diamine;benzene-1,3,5-tricarboxamide |
| SMILES | NC(=O)c1cc(C(N)=O)cc(C(N)=O)c1.Nc1ccccc1N |
| InChI | InChI=1S/C9H9N3O3.C6H8N2/c10-7(13)4-1-5(8(11)14)3-6(2-4)9(12)15;7-5-3-1-2-4-6(5)8/h1-3H,(H2,10,13)(H2,11,14)(H2,12,15);1-4H,7-8H2 |
| InChIKey | CUFZBIBECVKAHD-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 181.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|