About 2-methylaniline;naphthalene-2-carboxamide
2-methylaniline;naphthalene-2-carboxamide (PubChem CID 67824326) has the molecular formula C18H18N2O
and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-methylaniline;naphthalene-2-carboxamide.
Molecular Properties
| Compound Name | 2-methylaniline;naphthalene-2-carboxamide |
| PubChem CID | 67824326 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-methylaniline;naphthalene-2-carboxamide |
| SMILES | Cc1ccccc1N.NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H9NO.C7H9N/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;1-6-4-2-3-5-7(6)8/h1-7H,(H2,12,13);2-5H,8H2,1H3 |
| InChIKey | MHOFOLXFQSISID-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylaniline;naphthalene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylaniline;naphthalene-2-carboxamide?
The IUPAC name of 2-methylaniline;naphthalene-2-carboxamide (CID 67824326) is 2-methylaniline;naphthalene-2-carboxamide.
What is the SMILES notation for 2-methylaniline;naphthalene-2-carboxamide?
The canonical SMILES for 2-methylaniline;naphthalene-2-carboxamide is Cc1ccccc1N.NC(=O)c1ccc2ccccc2c1.
What is the InChIKey of 2-methylaniline;naphthalene-2-carboxamide?
The InChIKey is MHOFOLXFQSISID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO.C7H9N/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;1-6-4-2-3-5-7(6)8/h1-7H,(H2,12,13);2-5H,8H2,1H3.
What are the key properties of 2-methylaniline;naphthalene-2-carboxamide?
2-methylaniline;naphthalene-2-carboxamide has a molecular weight of 278.35 g/mol, XLogP of 3.52, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylaniline;naphthalene-2-carboxamide is sourced from PubChem (CID 67824326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).