About 2-methylaniline;terephthalic acid
2-methylaniline;terephthalic acid (PubChem CID 174605990) has the molecular formula C15H15NO4
and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-methylaniline;terephthalic acid.
Molecular Properties
| Compound Name | 2-methylaniline;terephthalic acid |
| PubChem CID | 174605990 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-methylaniline;terephthalic acid |
| SMILES | Cc1ccccc1N.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H6O4.C7H9N/c9-7(10)5-1-2-6(4-3-5)8(11)12;1-6-4-2-3-5-7(6)8/h1-4H,(H,9,10)(H,11,12);2-5H,8H2,1H3 |
| InChIKey | UJZZWJIDPLOBOK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylaniline;terephthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylaniline;terephthalic acid?
The IUPAC name of 2-methylaniline;terephthalic acid (CID 174605990) is 2-methylaniline;terephthalic acid.
What is the SMILES notation for 2-methylaniline;terephthalic acid?
The canonical SMILES for 2-methylaniline;terephthalic acid is Cc1ccccc1N.O=C(O)c1ccc(C(=O)O)cc1.
What is the InChIKey of 2-methylaniline;terephthalic acid?
The InChIKey is UJZZWJIDPLOBOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C7H9N/c9-7(10)5-1-2-6(4-3-5)8(11)12;1-6-4-2-3-5-7(6)8/h1-4H,(H,9,10)(H,11,12);2-5H,8H2,1H3.
What are the key properties of 2-methylaniline;terephthalic acid?
2-methylaniline;terephthalic acid has a molecular weight of 273.29 g/mol, XLogP of 2.66, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylaniline;terephthalic acid is sourced from PubChem (CID 174605990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).