About 2-methylaniline;2-methylprop-2-enoic acid
2-methylaniline;2-methylprop-2-enoic acid (PubChem CID 175783727) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-methylaniline;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 2-methylaniline;2-methylprop-2-enoic acid |
| PubChem CID | 175783727 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-methylaniline;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.Cc1ccccc1N |
| InChI | InChI=1S/C7H9N.C4H6O2/c1-6-4-2-3-5-7(6)8;1-3(2)4(5)6/h2-5H,8H2,1H3;1H2,2H3,(H,5,6) |
| InChIKey | PEOOHJLEKIQSGT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylaniline;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylaniline;2-methylprop-2-enoic acid?
The IUPAC name of 2-methylaniline;2-methylprop-2-enoic acid (CID 175783727) is 2-methylaniline;2-methylprop-2-enoic acid.
What is the SMILES notation for 2-methylaniline;2-methylprop-2-enoic acid?
The canonical SMILES for 2-methylaniline;2-methylprop-2-enoic acid is C=C(C)C(=O)O.Cc1ccccc1N.
What is the InChIKey of 2-methylaniline;2-methylprop-2-enoic acid?
The InChIKey is PEOOHJLEKIQSGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C4H6O2/c1-6-4-2-3-5-7(6)8;1-3(2)4(5)6/h2-5H,8H2,1H3;1H2,2H3,(H,5,6).
What are the key properties of 2-methylaniline;2-methylprop-2-enoic acid?
2-methylaniline;2-methylprop-2-enoic acid has a molecular weight of 193.25 g/mol, XLogP of 2.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylaniline;2-methylprop-2-enoic acid is sourced from PubChem (CID 175783727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).