C17H22O2 — CID 175445378
buta-1,3-diene;1-ethenyl-2-methylbenzene;2-methylprop-2-enoic acid (PubChem CID 175445378) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is buta-1,3-diene;1-ethenyl-2-methylbenzene;2-methylprop-2-enoic acid.
| Compound Name | buta-1,3-diene;1-ethenyl-2-methylbenzene;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 175445378 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | buta-1,3-diene;1-ethenyl-2-methylbenzene;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=CC=C.C=Cc1ccccc1C |
| InChI | InChI=1S/C9H10.C4H6O2.C4H6/c1-3-9-7-5-4-6-8(9)2;1-3(2)4(5)6;1-3-4-2/h3-7H,1H2,2H3;1H2,2H3,(H,5,6);3-4H,1-2H2 |
| InChIKey | NEQRZLJSGORFBC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|