C8H9N2O2P — CID 174651487
2-phosphanylbenzene-1,4-dicarboxamide (PubChem CID 174651487) has the molecular formula C8H9N2O2P and a molecular weight of 196.15 g/mol. Its IUPAC name is 2-phosphanylbenzene-1,4-dicarboxamide.
| Compound Name | 2-phosphanylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 174651487 |
| Molecular Formula | C8H9N2O2P |
| Molecular Weight | 196.15 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 2-phosphanylbenzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)c(P)c1 |
| InChI | InChI=1S/C8H9N2O2P/c9-7(11)4-1-2-5(8(10)12)6(13)3-4/h1-3H,13H2,(H2,9,11)(H2,10,12) |
| InChIKey | LASUMISYOLSZAW-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.15 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|