C12H10F7N3O2 — CID 140538447
2-(2,2,3,3,4,4,4-heptafluorobutylamino)benzene-1,4-dicarboxamide (PubChem CID 140538447) has the molecular formula C12H10F7N3O2 and a molecular weight of 361.22 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,4-heptafluorobutylamino)benzene-1,4-dicarboxamide.
| Compound Name | 2-(2,2,3,3,4,4,4-heptafluorobutylamino)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 140538447 |
| Molecular Formula | C12H10F7N3O2 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutylamino)benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)c(NCC(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F7N3O2/c13-10(14,11(15,16)12(17,18)19)4-22-7-3-5(8(20)23)1-2-6(7)9(21)24/h1-3,22H,4H2,(H2,20,23)(H2,21,24) |
| InChIKey | MXWPIKKFPQAGLE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|