C11H15N3O4S — CID 67418978
2-(2-methylsulfonylethylamino)benzene-1,4-dicarboxamide (PubChem CID 67418978) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-(2-methylsulfonylethylamino)benzene-1,4-dicarboxamide.
| Compound Name | 2-(2-methylsulfonylethylamino)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 67418978 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(2-methylsulfonylethylamino)benzene-1,4-dicarboxamide |
| SMILES | CS(=O)(=O)CCNc1cc(C(N)=O)ccc1C(N)=O |
| InChI | InChI=1S/C11H15N3O4S/c1-19(17,18)5-4-14-9-6-7(10(12)15)2-3-8(9)11(13)16/h2-3,6,14H,4-5H2,1H3,(H2,12,15)(H2,13,16) |
| InChIKey | ALGROMLUNAGEMC-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |