C9H10FN3O2 — CID 43706066
3-[(2-aminoacetyl)amino]-4-fluorobenzamide (PubChem CID 43706066) has the molecular formula C9H10FN3O2 and a molecular weight of 211.20 g/mol. Its IUPAC name is 3-[(2-aminoacetyl)amino]-4-fluorobenzamide.
| Compound Name | 3-[(2-aminoacetyl)amino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 43706066 |
| Molecular Formula | C9H10FN3O2 |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3-[(2-aminoacetyl)amino]-4-fluorobenzamide |
| SMILES | NCC(=O)Nc1cc(C(N)=O)ccc1F |
| InChI | InChI=1S/C9H10FN3O2/c10-6-2-1-5(9(12)15)3-7(6)13-8(14)4-11/h1-3H,4,11H2,(H2,12,15)(H,13,14) |
| InChIKey | MHDMWJQZGZQZOW-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |