C14H13FN4O2 — CID 107337783
3-[[2-(5-amino-2-pyridinyl)acetyl]amino]-4-fluorobenzamide (PubChem CID 107337783) has the molecular formula C14H13FN4O2 and a molecular weight of 288.28 g/mol. Its IUPAC name is 3-[[2-(5-amino-2-pyridinyl)acetyl]amino]-4-fluorobenzamide.
| Compound Name | 3-[[2-(5-amino-2-pyridinyl)acetyl]amino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 107337783 |
| Molecular Formula | C14H13FN4O2 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-[[2-(5-amino-2-pyridinyl)acetyl]amino]-4-fluorobenzamide |
| SMILES | NC(=O)c1ccc(F)c(NC(=O)Cc2ccc(N)cn2)c1 |
| InChI | InChI=1S/C14H13FN4O2/c15-11-4-1-8(14(17)21)5-12(11)19-13(20)6-10-3-2-9(16)7-18-10/h1-5,7H,6,16H2,(H2,17,21)(H,19,20) |
| InChIKey | NWKXMBJGZRUSFD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |