C10H11F3N2O — CID 102868551
3-(1,1-difluoropropan-2-ylamino)-4-fluorobenzamide (PubChem CID 102868551) has the molecular formula C10H11F3N2O and a molecular weight of 232.21 g/mol. Its IUPAC name is 3-(1,1-difluoropropan-2-ylamino)-4-fluorobenzamide.
| Compound Name | 3-(1,1-difluoropropan-2-ylamino)-4-fluorobenzamide |
|---|---|
| PubChem CID | 102868551 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-(1,1-difluoropropan-2-ylamino)-4-fluorobenzamide |
| SMILES | CC(Nc1cc(C(N)=O)ccc1F)C(F)F |
| InChI | InChI=1S/C10H11F3N2O/c1-5(9(12)13)15-8-4-6(10(14)16)2-3-7(8)11/h2-5,9,15H,1H3,(H2,14,16) |
| InChIKey | ANTPAZLVDXMQES-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |